Apoptotic agent-4 | MedChemExpress (MCE)
Apoptotic agent-4 (Compound 9) is a apoptosis inducer. Apoptotic agent-4 inhibits VEGFR-2 with an IC50 of 0.5717 μM. Apoptotic agent-4 inhibits cancer cell proliferation and arrests the cell at both the G2/M and Pre-G1 phases[1].
| Trivial name | Apoptotic agent-4 |
| Catalog Number | HY-158233 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | CC1CCN(S(=O)(C2=CC=C(/C(C)=N/NC(NC3=CC=C(OC)C=C3)=S)C=C2)=O)CC1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/apoptotic-agent-4.html |