Antitumor agent-153 | MedChemExpress (MCE)
Antitumor agent-153 (compound 11b) is an optimized H2A histone ubiquitination inhibitor based on PRT4165 (HY-19817). Antitumor agent-153 inhibits the viability of human osteosarcoma U2OS cells and reduces histone H2A monoubiquitination, exhibiting anticancer activity.[12][1].
| Trivial name | Antitumor agent-153 |
| Catalog Number | HY-163518 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(C/2=O)C=CC=C1)C2=C/C3=C([N+]([O-])=O)C=CC=C3[N+]([O-])=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/antitumor-agent-153.html |