Antitumor agent-151 | MedChemExpress (MCE)
Antitumor agent-151 (7k) is a significant HsClpP agonist and an antileukemia drug candidate. Antitumor agent-151 (7k) exhibits remarkably enhanced proteolytic activity of HsClpP (EC50 = 0.79 μM) and antitumor activity in vitro (IC50 = 0.038 μM). Antitumor agent-151 (7k) induces apoptosis[1].
| Trivial name | Antitumor agent-151 |
| Catalog Number | HY-162462 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(CCN(C1)CC2=CC(C#N)=CC=C2)N3)N=C3NCC4=CC=C(C=C4)F |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/antitumor-agent-151.html |