Antidepressant agent 6 | MedChemExpress (MCE)
Antidepressant agent 6 (S-3a) is a lead compound with potent and sustained antidepressant effects. Antidepressant agent 6 (S-3a) displays high cognitive safety margin.Antidepressant agent 6 (S-3a) antagonizes M1 receptors and elevates BDNF levels, suggesting its potential as an antidepressant for further exploration[1].

Trivial name | Antidepressant agent 6 |
Catalog Number | HY-157792 |
Research Area | Neurological Disease |
Purity | ≥98.0% |
SMILES | CN1[C@@H]2CC(C[C@H]1[C@@H]3O[C@@H]32)OC([C@@](CO)(C4=CC=CC=C4)F)=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/antidepressant-agent-6.html |