Anticancer agent 191 | MedChemExpress (MCE)
Anticancer agent 191 (Compound 2) is a derivative of probenecid (HY-B0545). As a cancer cell efflux inhibitor, Anticancer agent 191 is designed to inhibit P-glycoprotein (P-gp), breast cancer resistance protein (BCRP), and/or multiple multidrug resistance proteins (MRPs). Anticancer agent 191 increases the accumulation of vinblastine in cancer cells, which is used for cancer research[1].
| Trivial name | Anticancer agent 191 |
| Catalog Number | HY-157876 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | CCCN(S(=O)(C1=CC=C(C=C1)C(NCCCC[C@H](C(O)=O)N)=O)=O)CCC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/anticancer-agent-191.html |