Antibacterial agent 182 | MedChemExpress (MCE)
Antibacterial agent 182 (compound 8c) is an antibacterial agent that shows antibacterial activity against various Gram-positive bacteria, particularly against Vancomycin-resistant Enterococcus faecalis (MIC ≤0.125 μg/mL). Antibacterial agent 182 inhibits biofilm formation of Staphylococcus aureus and Pseudomonas aeruginosa at sub-MIC doses[1].
| Trivial name | Antibacterial agent 182 |
| Catalog Number | HY-161263 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | BrC(N1)=C(Br)C(Br)=C1C2=NC(C3=C(O)C(Br)=CC(C(F)(F)F)=C3)=CS2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/antibacterial-agent-182.html |