Anti-MRSA agent 10 | MedChemExpress (MCE)
Anti-MRSA agent 10 (Compound 2d) is a Cephalosporin (HY-144229) derivative and exhibits antibacterial activity. Anti-MRSA agent 10 is slightly drug resistane and exhibits low cytotoxicity in cells HUVEC and HBZY-1[1].
| Trivial name | Anti-MRSA agent 10 |
| Catalog Number | HY-161330 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | O=C1[C@@H](NC(/C(C2=CSC([NH3+])=N2)=N\OC)=O)[C@H]3SCC(C[N+]4=CC(C(NCCCCCCCC)=O)=CC=C4)=C(C([O-])=O)N31.[O-]C(C(F)(F)F)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/anti-mrsa-agent-10.html |