Ac-PSMA-trillium | MedChemExpress (MCE)
Ac-PSMA-trillium is a PSMA targeting compound, consisting of a PSMA targeting molecule (PSMA binder), a Macropa chelating molecule, and a group that regulates pharmacokinetics (PK modifier). Ac-PSMA-trillium is a non-radioactive form of Actinium-225-PSMA-Trillium (BAY 3563254) with improved PSMA targeting and pharmacokinetic properties. PSMA-trillium can bind Ac through the Macropa chelating molecule, or the radioactive isotope 225Actinium. Actinium-225-PSMA-Trillium is a potent inhibitor of metastatic castration-resistant prostate cancer (mCRPC)[1][2].

Trivial name | Ac-PSMA-trillium |
Catalog Number | HY-158119 |
Research Area | Cancer |
Purity | ≥98.0% |
SMILES | O=C(O)[C@H](CCC(O)=O)NC(N[C@@H](CCCCNC(NC1=CC(C2=CN(CCOCCOCCOCCC(N[C@@H](CCCCNC(NC3=CC=C(CCOC4=CC5=[N]C(C[N@@]67[Ac+3]([O](CC8)CC9)([O](CC%10)CC%11)([O]%10CC6)([O]8CC7)([O-]C%12=O)([O-]C5=O)[N@]9%11CC%13=CC=CC%12=[N]%13)=C4)C=C3)=S)C(NCCOCCOCCOCCOCCOCCOCCOCCOCCC(N[C@H](C(O)=O)CCCCNC(CCCC%14=CC=C(I)C=C%14)=O)=O)=O)=O)N=N2)=CC=C1)=O)C(O)=O)=O.C |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/ac-psma-trillium.html |