3-Fluoro-evodiamine glucose | MedChemExpress (MCE)
3-Fluoro-evodiamine glucose (Compound 8) is an evodiamine-glucose conjugate. 3-Fluoro-evodiamine glucose activates the expression of glucose transporter 1 (GLUT1), and inhibits topoisomerase I/II. 3-Fluoro-evodiamine glucose induces apoptosis and arrests the cell cycle at G2/M phase. 3-Fluoro-evodiamine glucose exhibits antitumor efficacy in vivo and in vitro, without significant toxicity[1].
| Trivial name | 3-Fluoro-evodiamine glucose |
| Catalog Number | HY-161501 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O[C@H]1[C@@H]([C@H]([C@@H](O[C@@H]1CO)OC2=CC3=C(NC4=C3CCN5[C@]4([H])N(C6=C(C5=O)C=C(F)C=C6)C)C=C2)O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/3-fluoro-evodiamine-glucose.html |