2-Heptanol-d5 | MedChemExpress (MCE)
2-Heptanol-d5 is deuterated labeled Citronellol (HY-W010201). Citronellol ((±)-Citronellol) is a monoterpene Pelargonium graveolens. Citronellol ((±)-Citronellol) induces necroptosis of cancer cell via up-regulating TNF-α, RIP1/RIP3 activities, down-regulating caspase-3/caspase-8 activities and increasing ROS (reactive oxygen species) accumulation[1].
| Trivial name | 2-Heptanol-d5 |
| Catalog Number | HY-W015879S |
| Research Area | Inflammation/Immunology |
| Purity | ≥98.0% |
| SMILES | CC(O)CCCC([2H])([2H])C([2H])([2H])[2H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-heptanol-d5.html |