Imisopasem manganese
Imisopasem manganese is a manganese-based non-peptidyl mimetic of the human mitochondrial manganese superoxide dismutase (MnSOD), with potential antioxidant and chemo/radioprotective activities. Imisopasem manganese mimics the activity of MnSOD and scavenges reactive oxygen species (ROS), such as superoxide anion, which prevents oxygen free radical damage to macromolecules such as DNA.
| Trivial name | Imisopasem manganese (RE1021) |
| Catalog Number | RE1021 |
| Alternative Name(s) | M40403; SC72325; CG4419 |
| Research Area | Other/Reagents |
| Molecular Formula | C₂₁H₃₅Cl₂MnN₅ |
| Inchi | InChI=1S/C21H35N5.2ClH.Mn/c1-3-10-20-18(8-1)22-12-13-23-19-9-2-4-11-21(19)25-15-17-7-5-6-16(26-17)14-24-20;;;/h5-7,18-25H,1-4,8-15H2;2*1H;/q;;;+2/p-2/t18-,19-,20-,21-;;;/m1.../s1 |
| Size | 10mg |
| Supplier Page | https://www.mitochondriasci.com/imisopasem-manganese-item-592.html |
| Additional Information | Appearance:Yellow solid |
