Destruxin B
Destruxin B is a cyclic hexadepsipeptide metabolite from the fungus Metarhizium anisopliae. It shows insecticidal and anti-cancer properties. It induces a concentration-dependent antiproliferative effect on lung adenocarcinoma A549 cells, with an IC₅₀ value of 4.9 μM. It induces apoptosis in the human non-small cell lung cancer cells A549 and H1299 cells via a Bcl-2 family-dependent mitochondrial pathway.
| Trivial name | Destruxin B (RE1046) |
| Catalog Number | RE1046 |
| Alternative Name(s) | 16-butan-2-yl-10,11,14-trimethyl-3-(2-methylpropyl)-13-propan-2-yl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone; SB 242536; NSC 236580 |
| Research Area | Other/Reagents |
| Molecular Formula | C₃₀H₅₁N₅O₇ |
| Inchi | InChI=1S/C30H51N5O7/c1-10-19(6)24-29(40)34(9)25(18(4)5)30(41)33(8)20(7)26(37)31-14-13-23(36)42-22(16-17(2)3)28(39)35-15-11-12-21(35)27(38)32-24/h17-22,24-25H,10-16H2,1-9H3,(H,31,37)(H,32,38) |
| Size | 10mg |
| Supplier Page | https://www.mitochondriasci.com/destruxin-b-item-617.html |
| Additional Information | Appearance:Solid |
