Chelerythrine chloride
Cell-permeable. A selective protein kinase C (PKC) inhibitor. Chelerythrine is at least 100-fold more selective for PKCs than for other kinases. It induces apoptotic cell death in polymorphonuclear leukocytes through activation of caspase-3.
| Trivial name | Chelerythrine chloride (RE1030) |
| Catalog Number | RE1030 |
| Alternative Name(s) | 1,2-Dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridinium chloride |
| Research Area | Other/Reagents |
| Molecular Formula | C₂₁H₁₈NO₄Cl |
| Inchi | InChI=1S/C21H18NO4.ClH/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22;/h4-10H,11H2,1-3H3;1H/q+1;/p-1 |
| Size | 10mg |
| Supplier Page | https://www.mitochondriasci.com/chelerythrine-chloride-item-601.html |
| Additional Information | Appearance:Yellow to orange solid |
