3-Nitropropionic acid
A plant and fungal toxin, 3-nitropropionic acid acts as an irreversible inactivator of succinate dehydrogenase. Selectively inhibits succinic dehydrogenase complex (Complex II) in the mitochondrial electron transport chain. Also shown to cause brain lesions similar to those of Huntington′s disease.
| Trivial name | 3-Nitropropionic acid (RE1012) |
| Catalog Number | RE1012 |
| Alternative Name(s) | 3-NP |
| Research Area | Other/Reagents |
| Molecular Formula | C₃H₅NO₄ |
| Inchi | InChI=1S/C3H5NO4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6) |
| Size | 10mg |
| Supplier Page | https://www.mitochondriasci.com/3-nitropropionic-acid-item-583.html |
| Additional Information | Appearance:Colorless to slight yellow solid |
