Rabeprazole magnesium
API Standard
| Catalog Number | CS-O-02286 |
| Alternative Name(s) | magnesium(2+) ion 2-{[4-(3-methoxypropoxy)-3- methylpyridin-2-yl]methanesulfinyl}-2,3-dihydro-1H- 1,3-benzodiazole-1,3-diide |
| Research Area | Rabeprazole is an antiulcer drug in the class of proton pump inhibitors. It is a prodrug - in the acid environment of the parietal cells it turns into active sulphenamide form. Rabeprazole inhibits the H+, K+ATPase of the coating gastric cells and dose-de |
| Molecular Formula | C18H21MgN3O3S |
| Purity | >98% |
| SMILES | O=S(CC1=C(C)C(OCCCOC)=CC=N1)C2[N-]C3=C([N-]2)C=CC=C3.[Mg+2] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02286.html |