Piribedil
API Standard
| Catalog Number | CS-T-40167 |
| Alternative Name(s) | 2-[4-(1,3-Benzodioxol-5-ylmethyl)-1-piperazinyl]pyrimidine |
| Research Area | Piribedil is an antiparkisonian agent that acts as a dopamine agonist. Piribedil also displays a2-adrenergic antagonist properties. Piribedil has also been shown to counteract age-related memory impairment by improving memory and attention as well as increasing the velocity of psychomotor reactions and lability of nervous processes. |
| Molecular Formula | C16H18N4O2 |
| CAS# | ######## |
| Purity | >98% |
| SMILES | C1(CN2CCN(C3=NC=CC=N3)CC2)=CC(OCO4)=C4C=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST40167.html |