Kadsurin A | MedChemExpress (MCE)
Kadsurin A is a new lignan can be isolated from Piper futokadsura. Kadsurin A is a platelet activating factor (PAF) receptor antagonist that weakly inhibits the binding of PAF to its receptor[1].
| Trivial name | Kadsurin A |
| Catalog Number | HY-N3436 |
| Research Area | Cardiovascular Disease |
| CAS# | 99340-07-5 |
| Purity | ≥98.00% |
| SMILES | CO[C@@]12[C@@]([C@@H]([C@@H](C3=CC=C(OCO4)C4=C3)O1)C)(C=C(C(C2)=O)CC=C)OC |
| PubChem Chemical Structure ID | 442885 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kadsurin-a.html |