Zolpidem Tartrate
API Standard
| Catalog Number | CS-O-02598 |
| Alternative Name(s) | (N,N,6-Trimethyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetamide,hemiTartrate);N,N-dimethyl-2-(6-methyl-2-(p-tolyl)imidazo[1,2-a]pyridin-3-ysalt |
| Research Area | Zolpidem Tartrate is a sedative primarily used for the treatment of insomnia. It is a short-acting nonbenzodiazepine compound of the imidazopyridine class that potentiates GABA, an inhibitory neurotransmitter, by binding to GABAA receptors at the same loc |
| Molecular Formula | C42H48N6O8 |
| CAS# | 99294-93-6 |
| Purity | >98% |
| SMILES | O[C@@H](C(O)=O)[C@@H](O)C(O)=O.O=C(N(C)C)CC1=C(C2=CC=C(C)C=C2)N=C3N1C=C(C)C=C3.O=C(N(C)C)CC4=C(C5=CC=C(C)C=C5)N=C6N4C=C(C)C=C6 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02598.html |
