Levodropropizine
Histamine receptor inhibitor,cough suppressant Neuroscience|Histamine Receptor
| Catalog Number | B1550-5.1 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C13H20N2O2 |
| CAS# | 99291-25-5 |
| Purity | 98% |
| SMILES | C1CN(CCN1CC(CO)O)C2=CC=CC=C2 |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1550 |
