(+)-Dropropizine
(+)-Dropropizine can inhibit histamine receptor, anti-allergic, and reduce a cough by modulation of neuropeptides involved in the cough reflex and by interfering with stimulus activation of peripheral endings of sensory nerves.
| Catalog Number | T0217L |
| Alternative Name(s) | (+)-Dropropizine |
| Research Area | Neuroscience|||Immunology/Inflammation|||GPCR/G Protein |
| Molecular Formula | C13H20N2O2 |
| CAS# | 99291-24-4 |
| Purity | 99.92% |
| SMILES | OC[C@H](O)CN1CCN(CC1)c1ccccc1 |
| Size | 1 g |
| Supplier Page | https://www.targetmol.com/compound/Levodropropizine |
| Additional Information | https://www.targetmol.com/datasheet/T0217L |
