Kushenol A
Kushenol A, a kind of Adenosine 3′, 5′-cyclic monophosphate(cAMP)phosphodiesterase inhibitiors isolated and purified from the roots of Sophora flavescens Ait., exhibits inhibitory activity against sodium-dependent glucose cotransporter 2(SGLT2 and shows selective alpha-glucosidase inhibitory activity.
| Trivial name | Kushenol-A |
| Catalog Number | CSN14297 |
| Alternative Name(s) | Kushenol-A |
| Research Area | / |
| Molecular Formula | C25H28O5 |
| CAS# | 99217-63-7 |
| Purity | ≥98% |
| SMILES | O=C1C[C@@H](C2=CC=CC=C2O)OC3=C(C[C@H](C(C)=C)C/C=C(C)\C)C(O)=CC(O)=C13 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/kushenol-a.html |