Rac-Nebivolol
API Standard
| Catalog Number | CS-O-01942 |
| Alternative Name(s) | 1-(6-fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)-2- {[2-(6-fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)-2- hydroxyethyl]amino}ethan-1-ol |
| Research Area | Nebivolol is a cardioselective ADRENERGIC BETA-1 RECEPTOR ANTAGONIST (beta-blocker) that functions as a VASODILATOR through the endothelial L-arginine/ NITRIC OXIDE system. It is used to manage HYPERTENSION and chronic HEART FAILURE in elderly patients. |
| Molecular Formula | C22H25F2NO4 |
| CAS# | 99200-09-06 |
| Purity | >98% |
| SMILES | O[C@H]([C@]1([H])OC2=CC=C(F)C=C2CC1)CNC[C@@H]([C@@]3([H])OC4=CC=C(F)C=C4CC3)O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01942.html |