Imiquimod
API Standard
| Catalog Number | CS-O-01653 |
| Alternative Name(s) | 1-(2-methylpropyl)-1H-imidazo[4,5c]quinolin-4- amine |
| Research Area | Imiquimod is a synthetic agent with immune response modifying activity. As an immune response modifier (IRM), imiquimod stimulates cytokine production, especially interferon production, and exhibits antitumor activity, particularly against cutaneous cance |
| Molecular Formula | C14H16N4 |
| CAS# | 99011-02-06 |
| Purity | >98% |
| SMILES | CC(C)CN1C2=C(C=CC=C3)C3=NC(N)=C2N=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01653.html |