Alfuzosin EP Impurity A
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-07133 |
| Alternative Name(s) | N-[3-[(4-Amino-6,7-dimethoxy-2-quinazolinyl)methylamino]propyl]-2-furancarboxamide Hydrochloride; Alfuzosin Impurity A; 2,3,4,5-Tetradehydro Alfuzosin Hydrochloride |
| Research Area | Impurity in commercial preparations of Alfuzosin. It is an impurity of Alfuzosin. Alfuzosin is an α1-adrenoceptor antagonist with antihypertensive activity. |
| Molecular Formula | C19H24ClN5O4 |
| CAS# | 98902-29-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC1=NC(N(C)CCCNC(C2=CC=CO2)=O)=NC3=CC(OC)=C(OC)C=C13.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07133.html |
| Additional Information | NULL |