Rhodamine 6G
Rhodamine 6G (R6G, Basic Red 1, Rhodamine 590) is a fluorescence tracer that binds to mitochondria, thus reducing the intact mitochondria number and inhibiting mitochondrial metabolic activity.
| Trivial name | R6G, Basic Red 1, Rhodamine 590 |
| Catalog Number | S3593 |
| Molecular Formula | C28H31ClN2O3 |
| CAS# | 989-38-8 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [Cl-].CCNC1=CC2=C(C=C1C)C(=C3C=C(C)C(C=C3O2)=[NH+]CC)C4=CC=CC=C4C(=O)OCC |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/rhodamine-6g.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3593-rhodamine-6g-chemical-structure.gif |