Benoxacor | MedChemExpress (MCE)
Benoxacor (CGA 154281) is a herbicide safener that can protect crops from the toxicity of herbicides. Benoxacor can enhance the activity of glutathione S-transferase (GST) in corn, effectively inducing detoxification of herbicides in corn[1].
| Trivial name | Benoxacor |
| Catalog Number | HY-W020788 |
| Alternative Name(s) | CGA 154281 |
| Research Area | Others |
| CAS# | 98730-04-2 |
| Purity | ≥98.0% |
| SMILES | ClC(Cl)C(N1C(C)COC2=CC=CC=C21)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/benoxacor.html |