L-Pyroglutamic acid
L-pyroglutamic acid (L-pyroglutamate, 5-Oxoproline, pidolic acid) is a natural nutrient and amino acid derived from glutamic acid. It is a metabolite in the glutathione cycle that is converted to glutamate by 5-oxoprolinase.
| Trivial name | L-pyroglutamate, 5-Oxoproline, pidolic acid |
| Catalog Number | S5823 |
| Molecular Formula | C21H21FN6O3 |
| CAS# | 98-79-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1CNC(=O)C2=C3N=C4N(CC5=C(O1)N=CC(=C5)F)C6CCCC6OC4=C[N]3N=C2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/l-pyroglutamic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/l-pyroglutamic-acid-chemical-structure-s5823.gif |