4-Aminophenylarsonic acid
4-Aminophenylarsonic acid (Arsanilic Acid) is an organoarsenic compound with activity as an anti-infective agent.This product is a hazardous chemical (acute toxicity/flammable/skin corrosive). Please use it while wearing a protective face mask, gloves, and clothing.
| Trivial name | Arsanilic acid, p-arsanilic acid |
| Catalog Number | S5099 |
| Molecular Formula | C6H8AsNO3 |
| CAS# | 98-50-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | NC1=CC=C(C=C1)[As](O)(O)=O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/4-aminophenylarsonic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/4-aminophenylarsonic-acid-chemical-structure-s5099.gif |