Methazathioprine 25mg
Metazathioprine is a methylated derivative of azathioprine (AZA). It demonstrated the greatest values of apparent and specific partition coefficients in n-octanol/phosphate buffer at pH 5.7 and pH 7.4 among purine derivatives such as 6-mercaptopurine (6-MP), 6-thioguanine (6-TG) and AZA.
Trivial name | Methazathioprine 25mg |
Catalog Number | A13510-25 |
Alternative Name(s) | 6-[(1,2-dimethyl-4-nitro-1H-imidazol-5-yl)sulfanyl]-7H-purine |
Molecular Formula | C₁₀H₉N₇O₂S |
CAS# | 97746-12-8 |
SMILES | CC1=NC(=C(N1C)SC2=NC=NC3=C2NC=N3)[N+](=O)[O-] |
Size | 25mg |
Supplier Page | http://www.adooq.com/methazathioprine.html |