Lucidone A | MedChemExpress (MCE)
Lucidone A is a lanostanoid isolated from the fruiting bodies of G. resinaceum. lucidone A showed inhibitory effects against the increase of ALT and AST levels in HepG2 cells induced by H2O2 compared to a control group in the range of their maximum non-toxic concentration (MNTC) [1].
| Trivial name | Lucidone A |
| Catalog Number | HY-N6595 |
| Research Area | Others |
| CAS# | 97653-92-4 |
| Purity | ≥98.00% |
| SMILES | C[C@@]12C3=C([C@H](C[C@@]1([H])C(C)([C@H](CC2)O)C)O)[C@]4([C@](CC3=O)([C@H](CC4=O)C(C)=O)C)C |
| PubChem Chemical Structure ID | 71453988 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lucidone-a.html |