LY 163443 | MedChemExpress (MCE)
LY 163443 is a selective antagonist of leukotrienes D4 (LTD4) and E4 (LTE4). LY 163443 can antagonize LTD4-induced contractions of guinea pig ileum, trachea, and lung parenchyma. LY 163443 also inhibits tracheal contractions to LTE4[1][2].
| Trivial name | LY 163443 |
| Catalog Number | HY-113758 |
| Research Area | Inflammation/Immunology |
| CAS# | 97581-70-9 |
| Purity | ≥98.00% |
| SMILES | CC(C1=CC=C(C(CCC)=C1O)COC2=CC=C(C=C2)CC3=NN=NN3)=O |
| PubChem Chemical Structure ID | 126778 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ly-163443.html |