Topiramate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02451 |
| Alternative Name(s) | 2,3:4,5-Di-O-isopropylidene-b-D-frctopyranose sulfamate; Topamax |
| Research Area | Topiramate is a sulfamate-substituted monosaccharide with anticonvulsant property. Although the mechanism of action has not been fully elucidated, topiramate antagonizes kainate/AMPA subtype of the glutamate receptors, which are ligand-activated cation ch |
| Molecular Formula | C12H21NO8S |
| CAS# | 97240-79-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[S](OC[C@]1(OC(C)(C)O2)[C@]2([H])[C@@](OC(C)(C)O3)([H])[C@@]3([H])CO1)(=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02451.html |
| Additional Information | NULL |