Cyproheptadine hydrochloride
serotonin and histamine antagonist as well as antimuscarinic reagent Neuroscience|Histamine Receptor
| Catalog Number | B3309-S |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C21H22ClN |
| CAS# | 969-33-5 |
| Purity | 98% |
| SMILES | CN1CCC(=C2C3=CC=CC=C3C=CC4=CC=CC=C42)CC1.Cl |
| Size | Evaluation Sample |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3309 |
