Indatraline HCl
Indatraline HCl is a potent 5-HT uptake inhibitor, and also inhibits dopamine and noradrenalin uptake with Ki of 0.42, 1.7 and 5.8 nM, respectively.
| Trivial name | Lu 19-005 |
| Catalog Number | CSN22856 |
| Alternative Name(s) | Lu 19-005 |
| Research Area | / |
| Molecular Formula | C16H15Cl2N.HCl |
| CAS# | 96850-13-4 |
| Purity | ≥98% |
| SMILES | ClC(C=C3)=C(Cl)C=[C@@]3[C@H]2C1=CC=CC=C1[C@H](NC)C2.Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/indatraline-hcl.html |