Orlistat
Orlistat is a general lipase inhibitor with IC50 of 122 ng/ml for PL from human duodenal juice. Orlistat treatment reduces proliferation, induces apoptosis and arrests cell cycle.
| Trivial name | Tetrahydrolipstatin,Ro 18-0647 | 
| Catalog Number | S1629 | 
| Molecular Formula | C23H24N4O | 
| CAS# | 96829-58-2 | 
| Inchi | #N/A | 
| Inchi Key | #N/A | 
| SMILES | CN1C/C=C/CCOC2=CC(=CC=C2)C3=CC=NC(=NC4=CC=CC(=C4)C1)N3 | 
| Size | 100mg | 
| Supplier Page | http://www.selleckchem.com/products/Orlistat(Alli).html | 
| Additional Information | https://file.selleck.cn/downloads/struct/Orlistat-Alli-Xenical-chemical-structure-S1629.gif | 
                    