Adenosine amine congener
Adenosine amine congener hydrate is a potent aqueous-soluble A1 adenosine receptor agonist with Ki value of 0.85nM for binding against [3H]N6-cyclohexyladenosine in rat cerebral cortex membranes.
| Trivial name | ADAC |
| Catalog Number | CSN25244 |
| Alternative Name(s) | ADAC |
| Research Area | / |
| Molecular Formula | C28H32N8O6 |
| CAS# | 96760-69-9 |
| Purity | ≥98% |
| SMILES | O=C(NCCN)CC1=CC=C(NC(CC2=CC=C(NC3=C4N=CN([C@@H]5O[C@H](CO)[C@@H](O)[C@H]5O)C4=NC=N3)C=C2)=O)C=C1 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/adenosine-amine-congener.html |