Epidermal Growth Factor Receptor Peptide (985-996) 25mg
Epidermal Growth Factor Receptor Peptide (985-996) exists on the cell surface and is activated by the binding of its specific ligands, including epidermal growth factor and transforming growth factor.
| Trivial name | Epidermal Growth Factor Receptor Peptide (985-996) 25mg |
| Catalog Number | A14877-25 |
| Alternative Name(s) | 5-amino-1-cyclopropyl-6,8-difluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| Molecular Formula | C61H93N13O23 |
| CAS# | 96249-43-3 |
| SMILES | CN1CCN(CC1)C2=C(C3=C(C(=C2F)N)C(=O)C(=CN3C4CC4)C(=O)O)F |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/epidermal-growth-factor-receptor-peptide-985-996.html |