ONX-0914 10mM * 1mL in DMSO
ONX 0914 is an immunoproteasome inhibitor with potential treatment applications in autoimmune disorders, such as rheumatoid arthritis, inflammatory bowel disease and lupus. ONX 0914 was designed to be a potent inhibitor of the immunoproteasome with minimal cross-reactivity for the constitutive proteasome.
| Trivial name | ONX-0914 10mM * 1mL in DMSO |
| Catalog Number | A12653-10mM-D |
| Alternative Name(s) | (S)-3-(4-methoxyphenyl)-N-((S)-1-((S)-2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl)-2-((S)-2-(2-morpholinoacetamido)propanamido)propanamide |
| Molecular Formula | C31H40N4O7 |
| CAS# | 960374-59-8 |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)OC)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)[C@]3(CO3)C)NC(=O)CN4CCOCC4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/onx-0914.html |