Meropenem 10mM * 1mL in DMSO
Meropenem is a ??-lactam antibiotic of the carbapenem subclass that has been shown to inhibit penicillinase-negative, -positive and methicillin-susceptible staphylococci.
Trivial name | Meropenem 10mM * 1mL in DMSO |
Catalog Number | A10569-10mM-D |
Alternative Name(s) | (4R,5S,6S)-3-((3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-ylthio)-6-((R)-1-hydroxyethyl)-4-methyl-7-oxo-1-aza-bicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
Molecular Formula | C17H25N3O5S |
CAS# | 96036-03-2 |
SMILES | C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H](NC3)C(=O)N(C)C)C(=O)O)[C@@H](C)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/meropenem.html |