Vortioxetine hydrobromide 10mM * 1mL in DMSO
Lu-AA21004 is an oral multimodal serotonergic agent, inhibits 5-HT(1A), 5-HT(1B), 5-HT(3A), 5-HT(7) and SERT with IC50 of 15 nM, 33 nM, 3.7 nM, 19 nM and 1.6 nM, respectively.
| Trivial name | Vortioxetine hydrobromide 10mM * 1mL in DMSO |
| Catalog Number | A12602-10mM-D |
| Alternative Name(s) | Piperazine, 1-[2-[(2,4-dimethylphenyl)thio]phenyl]-, hydrobromide (1:1) |
| Molecular Formula | C18H22N2S.HBr |
| CAS# | 960203-27-4 |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=CC=C2N3CCNCC3)C.Br |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/vortioxetine-lu-aa21004-hydrobromide.html |