α-Ethyl-3-hydroxy-2,4,6-triiodohydrocinnamic acid
α-Ethyl-3-hydroxy-2,4,6-triiodohydrocinnamic acid (Iophenoxic acid ) is an organic, iodine-containing compound. Iophenoxic acid is an iodinated radiocontrast agent, its clinical use has been withdrawn due to its exceptionally long half-life in the body, since it has high-affinity binding to human serum albumin (HSA). Structural basis of its interaction with HSA has been evaluated.
| Catalog Number | CBB1121195 |
| Alternative Name(s) | Iophenoxic acid |
| Molecular Formula | HOC6H(I)3CH2CH(C2H5)CO2H |
| CAS# | 96-84-4 |
| Purity | >97% |
| Inchi | 1S/C11H11I3O3/c1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h4-5,15H,2-3H2,1H3,(H,16,17) |
| Inchi Key | GOIQOQCNFWYSTQ-UHFFFAOYSA-N |
| SMILES | CCC(Cc1c(I)cc(I)c(O)c1I)C(O)=O |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/ethyl-3-hydroxy-246-triiodohydrocinnamic-acid-item-121195.html |
