(+)-UH 232 maleate
D2 antagonist
| Catalog Number | T23496 |
| Research Area | Others |
| Molecular Formula | C18H29NO |
| CAS# | 95999-12-5 |
| SMILES | O(C)C1=C2C([C@H](C)[C@H](N(CCC)CCC)CC2)=CC=C1 |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/(+)-UH 232 maleate |
| Additional Information | https://www.targetmol.com/datasheet/T23496 |
