Trimidox hydrochloride | MedChemExpress (MCE)
Trimidox hydrochloride (VF-233) is a ribonucleotide reductase inhibitor with antileukemic activities. Trimidox hydrochloride inhibits the growth of human promyelocytic leukemia HL-60 cells with an IC50 of 35 μM[1].
| Trivial name | Trimidox hydrochloride |
| Catalog Number | HY-111008A |
| Alternative Name(s) | VF-233 hydrochloride |
| Research Area | Cancer |
| CAS# | 95933-75-8 |
| Purity | ≥98.0% |
| SMILES | N=C(C1=CC(O)=C(O)C(O)=C1)NO.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/trimidox-hydrochloride.html |