A 922500 10mM * 1mL in DMSO
A 922500 is a diacylglycerol acyltransferase 1 (DGAT-1) inhibitor (IC50 values are 7 and 24 nM at human and mouse DGAT-1 respectively).
| Trivial name | A 922500 10mM * 1mL in DMSO |
| Catalog Number | A11199-10mM-D |
| Alternative Name(s) | (1R,2R)-2-[[4'-[[Phenylamino)carbony l]amino] [1,1'-biphenyl]-4-yl]carbonyl]cyclopentanecarboxyli c acid |
| Molecular Formula | C26H24N2O4 |
| CAS# | 959122-11-3 |
| SMILES | C1C[C@H]([C@@H](C1)C(=O)O)C(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)NC(=O)NC4=CC=CC=C4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/a-922500.html |