BTZ043 10mM * 1mL in DMSO
BTZ043 (BTZ038, BTZ044) inhibits decaprenylphosphoryl-??-d-ribose 2?-epimerase, which is an enzyme which produces the cell wall of the pathogenic bacterium Mycobacterium tuberculosis.
| Trivial name | BTZ043 10mM * 1mL in DMSO |
| Catalog Number | A10165-10mM-D |
| Alternative Name(s) | (S)-2-(2-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-8-nitro-6-(trifluoromethyl)-4H-benzo[e][1,3]thiazin-4-one |
| Molecular Formula | C17H16F3N3O5S |
| CAS# | 957217-65-1 |
| SMILES | CC1COC2(O1)CCN(CC2)C3=NC(=O)C4=CC(=CC(=C4S3)[N+](=O)[O-])C(F)(F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/btz043-btz038-btz044.html |
