Eplerenone Hydroxy acid Potassium Salt
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-05950 |
| Alternative Name(s) | (7a,11a,17a)-9,11-Epoxy-17-hydroxy-3-oxopregn-4-ene-7,21onopotassium Salt; c 70303; |
| Research Area | A metabolite of Eplerenone. Used in combination therapy for treatment of cardiovascular disorders. |
| Molecular Formula | C24H31KO7 |
| CAS# | 95716-98-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](C(C[C@H]1C(OC)=O)=CC2=O)(CC2)[C@]34[C@]1([H])[C@@](CC[C@@]5(O)CCC([O-])=O)([H])[C@]5(C)C[C@H]3O4.[K+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05950.html |
| Additional Information | NULL |