XL147 analogue
XL147 analogue (SAR245408) is a selective and reversible class I PI3K inhibitor for PI3Kα/δ/γ with IC50 of 39 nM/36 nM/23 nM in cell-free assays, less potent to PI3Kβ. XL147 analogue induces apoptosis. Phase 1/2.
| Trivial name | SAR245408 |
| Catalog Number | S1118 |
| Molecular Formula | C7H8O2 |
| CAS# | 956958-53-5 |
| Inchi | InChI=1S/C7H8O2/c8-5-6-2-1-3-7(9)4-6/h1-4,8-9H,5H2 |
| Inchi Key | OKVJCVWFVRATSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)CO |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/XL147.html |
| Additional Information | https://file.selleck.cn/downloads/struct/XL147-chemical-structure-S1118.gif |