XL147 analogue
XL147 analogue (SAR245408) is a selective and reversible class I PI3K inhibitor for PI3Kα/δ/γ with IC50 of 39 nM/36 nM/23 nM in cell-free assays, less potent to PI3Kβ. XL147 analogue induces apoptosis. Phase 1/2.
| Trivial name | SAR245408 |
| Catalog Number | S1118 |
| Molecular Formula | C11H8O3 |
| CAS# | 956958-53-5 |
| Inchi | InChI=1S/C11H8O3/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h1-6,12H,(H,13,14) |
| Inchi Key | SJJCQDRGABAVBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2O)C(=O)O |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/XL147.html |
| Additional Information | https://file.selleck.cn/downloads/struct/XL147-chemical-structure-S1118.gif |