Lorcaserin EP Impurity B
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-32450 |
| Alternative Name(s) | 2-chloro-N-(4-Chlorophenyl)ethyl]amino]-2-chloropropane hydrochloride. |
| Research Area | 4-Chloro-N-(2-chloropropyl)benzeneethanamine Hydrochloride is used as a reagent in the synthesis of Lorcaserin (L469890, HCl); a novel selective 5-HT2C-receptor agonist for the treatment of obesity. |
| Molecular Formula | C11H16Cl3N |
| CAS# | 953789-37-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(Cl)CNCCC1=CC=C(Cl)C=C1.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO32450.html |
| Additional Information | NULL |
