Quizartinib (AC220)
Quizartinib (AC220) is a second-generation FLT3 inhibitor for Flt3(ITD/WT) with IC50 of 1.1 nM/4.2 nM in MV4-11 and RS4;11 cells, respectively, 10-fold more selective for Flt3 than KIT, PDGFRα, PDGFRβ, RET, and CSF-1R. Quizartinib (AC220) induces apoptosis of tumor cells. Phase 3.
| Trivial name | N/A |
| Catalog Number | S1526 |
| Molecular Formula | C26H29N5O4S |
| CAS# | 950769-58-1 |
| SMILES | COC1=C(OC)C(=CC(=C1)C(=O)NC2=CC=CC=C2C3=C[N]4C(=CSC4=N3)CN5CCNCC5)OC |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/AC-220.html |
| Additional Information | https://file.selleck.cn/downloads/struct/AC220-chemical-structure-S1526.gif |